| Name |
Lathodoratin |
| Formula |
C11H10O4 |
| Mw |
206.05790881 |
| CAS RN |
76693-50-0 |
| C_ID |
C00002433
, 
|
| InChIKey |
SCZKCXUGDWJJGV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H10O4/c1-2-6-5-15-9-4-7(12)3-8(13)10(9)11(6)14/h3-5,12-13H,2H2,1H3 |
| SMILES |
CCc1coc2cc(O)cc(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lathyrus hirsutus | Ref. |
| Plantae | Fabaceae | Lathyrus odorata | Ref. |
| Plantae | Fabaceae | Lathyrus odoratus  | Ref. |
|
|
zoom in
| Organism | Lathyrus odorata |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
