| Name |
Ecgonine |
| Formula |
C9H15NO3 |
| Mw |
185.10519335 |
| CAS RN |
481-37-8 |
| C_ID |
C00002291
, 
|
| InChIKey |
PHMBVCPLDPDESM-PVACCKEGNA-N |
| InChICode |
InChI=1S/C9H15NO3/c1-10-5-2-3-6(10)8(9(12)13)7(11)4-5/h5-8,11H,2-4H2,1H3,(H,12,13)/t5-,6+,7-,8-/m0/s1 |
| SMILES |
CN1C2CC[C@@H]1C[C@H](O)C2C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
|
|
zoom in
| Organism | Erythroxylum novogranatense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|