| Name |
Atropine |
| Formula |
C17H23NO3 |
| Mw |
289.16779361 |
| CAS RN |
51-55-8 |
| C_ID |
C00002277
, 
|
| InChIKey |
RKUNBYITZUJHSG-FCILSFPONA-N |
| InChICode |
InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15+,16-/m0/s1 |
| SMILES |
CN1C2CC[C@@H]1C[C@@H](OC(=O)[C@@H](CO)c1ccccc1)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Solanaceae | Atropa baetica | Ref. |
| Plantae | Solanaceae | Atropa bella-donna | Ref. |
| Plantae | Solanaceae | Atropa belladonna  | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
| Plantae | Solanaceae | Datura stramonium  | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Mandragora officinarum L.  | Ref. |
| Plantae | Solanaceae | Scopolia carniolica  | Ref. |
| - | - | Hyoscamus albus | Ref. |
| - | - | Hyoscamus aurea | Ref. |
| - | - | Hyoscamus muticus | Ref. |
| - | - | Hyoscamus niger | Ref. |
| - | - | Hyoscamus reticulatus | Ref. |
|
|
zoom in
| Organism | Atropa baetica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|