| Name |
Solanidine |
| Formula |
C27H43NO |
| Mw |
397.334465 |
| CAS RN |
80-78-4 |
| C_ID |
C00002261
, 
|
| InChIKey |
JVKYZPBMZPJNAJ-PQBWWHDJNA-N |
| InChICode |
InChI=1S/C27H43NO/c1-16-5-8-23-17(2)25-24(28(23)15-16)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h6,16-17,19-25,29H,5,7-15H2,1-4H3/t16-,17+,19-,20+,21-,22-,23-,24-,25-,26-,27-/m0/s1 |
| SMILES |
C[C@H]1CC[C@H]2[C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@@H](O)CC[C@]6(C)[C@H]5CC[C@]34C)N2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Liliaceae | Fritillaria camtschatcensis | Ref. |
| Plantae | Liliaceae | Fritillaria cirrhosa  | Ref. |
| Plantae | Liliaceae | Fritillaria tortifolia | Ref. |
| Plantae | Liliaceae | Fritillaria ussuriensis  | Ref. |
| Plantae | Liliaceae | Fritillaria verticillata var.thunbergii  | Ref. |
| Plantae | Melanthiaceae | Veratrum grandiflorum | Ref. |
| Plantae | Melanthiaceae | Veratrum mentzeanum | Ref. |
| Plantae | Melanthiaceae | Veratrum nigrum  | Ref. |
| Plantae | Melanthiaceae | Veratrum taliense | Ref. |
| Plantae | Solanaceae | Capsicum frutescens  | Ref. |
| Plantae | Solanaceae | Solanum americanum  | Ref. |
| Plantae | Solanaceae | Solanum chacoense | Ref. |
| Plantae | Solanaceae | Solanum chenopodioides | Ref. |
| Plantae | Solanaceae | Solanum nigrum  | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Solanaceae | Solanum villosum  | Ref. |
| Plantae | Solanaceae | Solanum xanthocarpum  | Ref. |
|
|
zoom in
| Organism | Fritillaria cirrhosa | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Ruan, et al., NPRD, 14, (2002), 80 |
|---|
|