| Name |
Symphytine |
| Formula |
C20H31NO6 |
| Mw |
381.21513773 |
| CAS RN |
22571-95-5 |
| C_ID |
C00002123
, 
|
| InChIKey |
MVWPTZQHBOWRTF-CUGQNHOLNA-N |
| InChICode |
InChI=1S/C20H31NO6/c1-6-13(4)18(23)27-16-8-10-21-9-7-15(17(16)21)11-26-19(24)20(25,12(2)3)14(5)22/h6-7,12,14,16-17,22,25H,8-11H2,1-5H3/b13-6+/t14-,16+,17+,20-/m0/s1 |
| SMILES |
C/C=C(C)C(=O)O[C@@H]1CCN2CC=C(COC(=O)[C@](O)(C(C)C)[C@H](C)O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Myosotis scorpioides | Ref. |
| Plantae | Boraginaceae | Symphytum asperum | Ref. |
| Plantae | Boraginaceae | Symphytum bohemium | Ref. |
| Plantae | Boraginaceae | Symphytum caucasicum | Ref. |
| Plantae | Boraginaceae | Symphytum consolidum | Ref. |
| Plantae | Boraginaceae | Symphytum grandiflorum | Ref. |
| Plantae | Boraginaceae | Symphytum ibericum | Ref. |
| Plantae | Boraginaceae | Symphytum officinale  | Ref. |
| Plantae | Boraginaceae | Symphytum officinalis | Ref. |
| Plantae | Boraginaceae | Symphytum orientale | Ref. |
| Plantae | Boraginaceae | Symphytum peregrinum | Ref. |
| Plantae | Boraginaceae | Symphytum tanaiense | Ref. |
| Plantae | Boraginaceae | Symphytum tuberosum | Ref. |
| Plantae | Boraginaceae | Symphytum uplandicum | Ref. |
| Plantae | Boraginaceae | Symphytum x uplandicum | Ref. |
| - | - | Symphytine | Ref. |
|
|
zoom in
| Organism | Symphytum asperum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|