| Name |
Lasiocarpine |
| Formula |
C21H33NO7 |
| Mw |
411.22570242 |
| CAS RN |
303-34-4 |
| C_ID |
C00002097
, 
|
| InChIKey |
QHOZSLCIKHUPSU-WMZRPMCLNA-N |
| InChICode |
InChI=1S/C21H33NO7/c1-7-13(2)18(23)29-16-9-11-22-10-8-15(17(16)22)12-28-19(24)21(26,14(3)27-6)20(4,5)25/h7-8,14,16-17,25-26H,9-12H2,1-6H3/b13-7-/t14-,16+,17-,21+/m1/s1 |
| SMILES |
C/C=C(/C)C(=O)O[C@H]1CCN2CC=C(COC(=O)[C@@](O)([C@@H](C)OC)C(C)(C)O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio oryzetorum | Ref. |
| Plantae | Boraginaceae | Cynoglossum officinale  | Ref. |
| Plantae | Boraginaceae | Heliotropium arbainense | Ref. |
| Plantae | Boraginaceae | Heliotropium arborescens | Ref. |
| Plantae | Boraginaceae | Heliotropium bacciferum  | Ref. |
| Plantae | Boraginaceae | Heliotropium bovei | Ref. |
| Plantae | Boraginaceae | Heliotropium circinatum | Ref. |
| Plantae | Boraginaceae | Heliotropium curassavicum | Ref. |
| Plantae | Boraginaceae | Heliotropium eichwaldii | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum  | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutissimum | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutum | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Boraginaceae | Heliotropium lasiocarpum | Ref. |
| Plantae | Boraginaceae | Heliotropium olgae | Ref. |
| Plantae | Boraginaceae | Heliotropium rotundifolium | Ref. |
| Plantae | Boraginaceae | Heliotropium supinum | Ref. |
| Plantae | Boraginaceae | Lappula intermedia | Ref. |
| Plantae | Boraginaceae | Symphytum asperum | Ref. |
| Plantae | Boraginaceae | Symphytum caucasicum | Ref. |
| Plantae | Boraginaceae | Symphytum caucasium | Ref. |
| Plantae | Boraginaceae | Symphytum officinale  | Ref. |
| Plantae | Boraginaceae | Symphytum officinalis | Ref. |
| - | - | Heliotorpium digynum | Ref. |
|
|
zoom in
| Organism | Cynoglossum officinale | | Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|