| Name |
(-)-Hygroline Hygroline |
| Formula |
C8H17NO |
| Mw |
143.13101417 |
| CAS RN |
496-47-9 |
| C_ID |
C00002047
, 
|
| InChIKey |
CWMYODFAUAJKIV-YZYOREDDNA-N |
| InChICode |
InChI=1S/C8H17NO/c1-7(10)6-8-4-3-5-9(8)2/h7-8,10H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| SMILES |
C[C@@H](O)C[C@H]1CCCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
| Plantae | Solanaceae | Schizanthus hookeri | Ref. |
|
|
zoom in
| Organism | Erythroxylum novogranatense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|