| Name |
beta-Skytanthine |
| Formula |
C11H21N |
| Mw |
167.16739968 |
| CAS RN |
24282-31-3 |
| C_ID |
C00001982
, 
|
| InChIKey |
HGTMGCDIPYGVKA-KBEVCLABNA-N |
| InChICode |
InChI=1S/C11H21N/c1-8-4-5-10-9(2)6-12(3)7-11(8)10/h8-11H,4-7H2,1-3H3/t8-,9+,10+,11-/m0/s1 |
| SMILES |
C[C@@H]1CN(C)C[C@@H]2[C@@H]1CC[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Skytanthus acutus | Ref. |
| - | - | family Asteraceae spp. | Ref. |
|
|
zoom in
| Organism | family Asteraceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|