| Name |
Phaeantharine |
| Formula |
C39H40N2O6 |
| Mw |
632.28863702 |
| CAS RN |
27670-80-0 |
| C_ID |
C00001902
, 
|
| InChIKey |
IWKHGZDMTOKGQP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C39H40N2O6/c1-40-16-14-27-21-35(43-4)37(45-6)23-30(27)32(40)18-25-8-11-29(12-9-25)47-39-20-26(10-13-34(39)42-3)19-33-31-24-38(46-7)36(44-5)22-28(31)15-17-41(33)2/h8-17,20-24H,18-19H2,1-7H3/q+2 |
| SMILES |
COc1cc2cc[n+](C)c(Cc3ccc(Oc4cc(Cc5c6cc(OC)c(OC)cc6cc[n+]5C)ccc4OC)cc3)c2cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Phaeanthus ebracteolatus | Ref. |
| Plantae | Annonaceae | Phaeanthus ebrateolatus | Ref. |
|
|
zoom in
| Organism | Phaeanthus ebrateolatus | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|