| Name |
Trichotomine |
| Formula |
C30H20N4O6 |
| Mw |
532.1382844 |
| CAS RN |
53472-14-3 |
| C_ID |
C00001777
, 
|
| InChIKey |
LOHPAPKRMNSIDN-PJWPLZPDNA-N |
| InChICode |
InChI=1S/C30H20N4O6/c35-27-17(11-21-25-15(9-23(29(37)38)33(21)27)13-5-1-3-7-19(13)31-25)18-12-22-26-16(14-6-2-4-8-20(14)32-26)10-24(30(39)40)34(22)28(18)36/h1-8,11-12,23-24,31-32H,9-10H2,(H,37,38)(H,39,40)/b18-17-/t23-,24-/m0/s1 |
| SMILES |
O=C(O)[C@@H]1Cc2c([nH]c3ccccc23)C2=C/C(=C3/C=C4c5[nH]c6ccccc6c5C[C@@H](C(=O)O)N4C3=O)C(=O)N21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Clerodendrum trichotomum  | Ref. |
| Plantae | Labiatae | Premna microphylla | Ref. |
| Plantae | Verbenaceae | Clerodendron trichotomum | Ref. |
|
|
zoom in
| Organism | Premna microphylla | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|