| Name |
Lappaconitine |
| Formula |
C32H44N2O8 |
| Mw |
584.3097664 |
| CAS RN |
32854-75-4 |
| C_ID |
C00001650
, 
|
| InChIKey |
NWBWCXBPKTTZNQ-DJACMGDFNA-N |
| InChICode |
InChI=1S/C32H44N2O8/c1-6-34-16-29(42-28(36)18-9-7-8-10-21(18)33-17(2)35)12-11-25(40-4)31-23(29)14-20(26(31)34)30(37)15-22(39-3)19-13-24(31)32(30,38)27(19)41-5/h7-10,19-20,22-27,37-38H,6,11-16H2,1-5H3,(H,33,35)/t19-,20+,22+,23-,24+,25+,26-,27+,29-,30+,31+,32+/m1/s1 |
| SMILES |
CCN1C[C@]2(OC(=O)c3ccccc3NC(C)=O)CC[C@H](OC)[C@]34C1[C@H](C[C@H]23)[C@@]1(O)C[C@H](OC)[C@H]2C[C@@H]4[C@]1(O)[C@H]2OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum barbatum var.puberulum | Ref. |
| Plantae | Ranunculaceae | Aconitum excelsum | Ref. |
| Plantae | Ranunculaceae | Aconitum finetianum | Ref. |
| Plantae | Ranunculaceae | Aconitum laeve | Ref. |
| Plantae | Ranunculaceae | Aconitum leucostomum Worosch. | Ref. |
| Plantae | Ranunculaceae | Aconitum orientale | Ref. |
| Plantae | Ranunculaceae | Aconitum ranunculaefolium | Ref. |
| Plantae | Ranunculaceae | Aconitum septentrionale | Ref. |
| Plantae | Ranunculaceae | Aconitum sinomontanum | Ref. |
| Plantae | Ranunculaceae | Delphinium cashmerianum  | Ref. |
|
|
zoom in
| Organism | Aconitum excelsum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yang, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 35, (2000), 208.
Shaheen, et al., Phytochemistry, 66, (2005), 935
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter19 |
|---|
|