| Name |
Carinatine |
| Formula |
C17H21NO4 |
| Mw |
303.14705817 |
| CAS RN |
64937-89-9 |
| C_ID |
C00001567
, 
|
| InChIKey |
KJPYARWZKKTTBA-FDQDZQOGNA-N |
| InChICode |
InChI=1S/C17H21NO4/c1-21-13-6-10-8-18-4-3-9-5-14(22-2)17(20)15(16(9)18)11(10)7-12(13)19/h5-7,14-17,19-20H,3-4,8H2,1-2H3/t14-,15-,16+,17+/m0/s1 |
| SMILES |
COc1cc2c(cc1O)[C@@H]1[C@H](O)[C@@H](OC)C=C3CCN(C2)[C@H]31 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Zephyranthes carinata  | Ref. |
| Plantae | Amaryllidaceae | Zephyranthes grandiflora  | Ref. |
|
|
zoom in
| Organism | Zephyranthes grandiflora | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
|---|
|