| Name |
Pyridoxine |
| Formula |
C8H11NO3 |
| Mw |
169.07389323 |
| CAS RN |
65-23-6 |
| C_ID |
C00001551
, 
|
| InChIKey |
LXNHXLLTXMVWPM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H11NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,10-12H,3-4H2,1H3 |
| SMILES |
Cc1ncc(CO)c(CO)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Arg L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Bovidae | Bos taurus domesticus  | Ref. |
| Fungi | Agaricaceae | Agaricus campestris  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Illiciaceae | Illicium verum  | Ref. |
| Plantae | Poaceae | Saccharum sinensis | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Zamiaceae | Apis cerana  | Ref. |
| - | - | | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Agaricus campestris | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|