| Name |
gamma-Undecalactone |
| Formula |
C11H20O2 |
| Mw |
184.14632988 |
| CAS RN |
104-67-6 |
| C_ID |
C00001329
, 
|
| InChIKey |
PHXATPHONSXBIL-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3/t10-/m1/s1 |
| SMILES |
CCCCCCC[C@H]1CCC(=O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Rosaceae | Prunus armeniaca L. (K604-19) | Ref. |
| Plantae | Rosaceae | Prunus persica | Ref. |
| Plantae | Solanaceae | Capsicum annuum | Ref. |
|
|
zoom in
| Organism | Bupleurum chinense |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
