| Name |
Propane-2-thiol |
| Formula |
C3H8S |
| Mw |
76.03467099 |
| CAS RN |
75-33-2 |
| C_ID |
C00001268
, 
|
| InChIKey |
KJRCEJOSASVSRA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C3H8S/c1-3(2)4/h3-4H,1-2H3 |
| SMILES |
CC(C)S |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Solanaceae | Solanum tuberosa | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Solanum tuberosa | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|