| Name |
Adipic acid Hexanedioic acid |
| Formula |
C6H10O4 |
| Mw |
146.05790881 |
| CAS RN |
124-04-9 |
| C_ID |
C00001178
, 
|
| InChIKey |
WNLRTRBMVRJNCN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10) |
| SMILES |
O=C(O)CCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rosaceae | Rubus idaeus  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Colocasia esculenta | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|