| Name |
Robinobiose |
| Formula |
C12H22O10 |
| Mw |
326.12129692 |
| CAS RN |
17074-00-9 |
| C_ID |
C00001146
, 
|
| InChIKey |
OVVGHDNPYGTYIT-PJOISBOQNA-N |
| InChICode |
InChI=1S/C12H22O10/c1-3-5(13)7(15)10(18)12(21-3)20-2-4-6(14)8(16)9(17)11(19)22-4/h3-19H,2H2,1H3/t3-,4-,5+,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| SMILES |
CC1O[C@@H](OC[C@H]2OC(O)[C@H](O)[C@@H](O)C2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
| - | - | occurs in many plants | Ref. |
|
|
zoom in
| Organism | occurs in many plants | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|