| Name |
Nobiletin 3',4',5,6,7,8-Hexamethoxyflavone |
| Formula |
C21H22O8 |
| Mw |
402.13146768 |
| CAS RN |
478-01-3 |
| C_ID |
C00001076
, 
|
| InChIKey |
MRIAQLRQZPPODS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H22O8/c1-23-13-8-7-11(9-15(13)24-2)14-10-12(22)16-17(25-3)19(26-4)21(28-6)20(27-5)18(16)29-14/h7-10H,1-6H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratum conyzoides  | Ref. |
| Plantae | Asteraceae | Blumea glomerata | Ref. |
| Plantae | Asteraceae | Conoclinium greggii | Ref. |
| Plantae | Asteraceae | Eupatorium coelestinum | Ref. |
| Plantae | Asteraceae | Eupatorium leucolepsis | Ref. |
| Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
| Plantae | Asteraceae | Viguiera rosei | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Lauraceae | Laurus nobilis L.  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus deliciosa | Ref. |
| Plantae | Rutaceae | Citrus hassaku  | Ref. |
| Plantae | Rutaceae | Citrus mitis | Ref. |
| Plantae | Rutaceae | Citrus nobilis  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata tangerine  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus tankan | Ref. |
| Plantae | Rutaceae | Fortunella japonica  | Ref. |
| Plantae | Rutaceae | Fortunella margarita  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| - | - | Xinhui citrus | Ref. |
|
|
zoom in
| Organism | Ageratum conyzoides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Herz,Phytochem.,21,(1982),2363
Machida,Chem.Pharm.Bull.,37,(1989),1092 |
|---|
|