| Name |
5,7-Dimethoxyflavone chrysin 5,7-dimethyl ether |
| Formula |
C17H14O4 |
| Mw |
282.08920894 |
| CAS RN |
21392-57-4 |
| C_ID |
C00001028
, 
|
| InChIKey |
JRFZSUMZAUHNSL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| SMILES |
COc1cc(OC)c2c(=O)cc(-c3ccccc3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum herbaceum | Ref. |
| Plantae | Asteraceae | Helichrysum nitens | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Helichrysum nitens | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Bohlmann,Phytochem.,18,(1979),1375
Jaipetch,Phytochem.,22,(1983)625 |
|---|
|