| Name |
Baicalin Baicalein 7-glucuronide |
| Formula |
C21H18O11 |
| Mw |
446.08491142 |
| CAS RN |
21967-41-9 |
| C_ID |
C00001024
, 
|
| InChIKey |
IKIIZLYTISPENI-GGNWGOABNA-N |
| InChICode |
InChI=1S/C21H18O11/c22-9-6-10(8-4-2-1-3-5-8)30-11-7-12(14(23)15(24)13(9)11)31-21-18(27)16(25)17(26)19(32-21)20(28)29/h1-7,16-19,21,23-27H,(H,28,29)/t16-,17-,18+,19-,21+/m0/s1 |
| SMILES |
O=C(O)C1O[C@@H](Oc2cc3oc(-c4ccccc4)cc(=O)c3c(O)c2O)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Oroxylum indicum  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Scutellaria amoena | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria hypericifolia | Ref. |
| Plantae | Labiatae | Scutellaria lateriflora  | Ref. |
| Plantae | Labiatae | Scutellaria oreophila | Ref. |
| Plantae | Labiatae | Scutellaria rehderiana | Ref. |
| Plantae | Labiatae | Scutellaria scordifolia | Ref. |
| Plantae | Labiatae | Scutellaria viscidula | Ref. |
| Plantae | Labiatae | Sideritis baicalensis | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
|
|
zoom in
| Organism | Trifolium pratense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|