| Name |
Strobopinin |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
491-66-7 |
| C_ID |
C00001006
, 
|
| InChIKey |
INBPQAJYHSJVRY-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C16H14O4/c1-9-11(17)7-14-15(16(9)19)12(18)8-13(20-14)10-5-3-2-4-6-10/h2-7,13,17,19H,8H2,1H3/t13-/m0/s1 |
| SMILES |
Cc1c(O)cc2c(c1O)C(=O)C[C@@H](c1ccccc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Alnus sieboldiana | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Pinaceae | Pinus krempfii | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| Plantae | Piperaceae | Piper hostmannianum var.berbicense | Ref. |
| Plantae | Pteridaceae | Pityrogramma pallida | Ref. |
|
|
zoom in
| Organism | Leptospermum scoparium | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 257,Flavanones and dihydroflavonols
Lindstedt,Acta Chem.Scand.,5,(1951),129
Wollenweber,Z.Pflanzenphysiol.,94,(1979),241 |
|---|
|