| Name |
Naringenin 7-O-beta-D-glucopyranoside Naringenin 7-O-beta-D-glucoside Prunin 5,7,4'-Trihydroxyflavanone 7-O-beta-D-glucopyranoside Naringenin 7-O-glucoside |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
529-55-5 |
| C_ID |
C00000998
, 
|
| InChIKey |
DLIKSSGEMUFQOK-HFABFWGWNA-N |
| InChICode |
InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-6,14,16,18-24,26-28H,7-8H2/t14-,16+,18-,19-,20+,21+/m0/s1 |
| SMILES |
O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Coriariaceae | Coriaria sp. | Ref. |
| Plantae | Cruciferae | Matthiola sp. | Ref. |
| Plantae | Dryopteridaceae | Dryopteris sp. | Ref. |
| Plantae | Fabaceae | Acacia dealbata | Ref. |
| Plantae | Fabaceae | Crotalaria assamica | Ref. |
| Plantae | Fabaceae | Crotalaria pallida  | Ref. |
| Plantae | Fabaceae | Peltophorum pterocarpum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Abies spp. | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Plantaginaceae | Antirrhinum sp. | Ref. |
| Plantae | Poaceae | Miscanthus sinensis | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Santalaceae | Viscum articulactum | Ref. |
| Plantae | Santalaceae | Viscum coloratum (KOMAR) NAKAI  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| - | - | Myrcianthes pungens | Ref. |
|
|
zoom in
| Organism | Matthiola sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 308,Flavanones and dihydroflavonols
Hasegawa,J.Am.Chem.Soc.,74,(1952),6114 |
|---|
|