| Name |
Dihydrochrysin Pinocembrin |
| Formula |
C15H12O4 |
| Mw |
256.07355887 |
| CAS RN |
480-39-7 |
| C_ID |
C00000992
, 
|
| InChIKey |
URFCJEUYXNAHFI-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C15H12O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-7,13,16-17H,8H2/t13-/m0/s1 |
| SMILES |
O=C1C[C@@H](c2ccccc2)Oc2cc(O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Anomianthus dulcis  | Ref. |
| Plantae | Annonaceae | Goniothalamus griffithii | Ref. |
| Plantae | Annonaceae | Uvaria chamae  | Ref. |
| Plantae | Asteraceae | Flourensia hirsuta | Ref. |
| Plantae | Asteraceae | Flourensia ilicifolia | Ref. |
| Plantae | Asteraceae | Flourensia retinophylla | Ref. |
| Plantae | Asteraceae | Helichrysum forskahlii  | Ref. |
| Plantae | Asteraceae | Helichrysum italicum  | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Phonus arborescens | Ref. |
| Plantae | Betulaceae | Alnus spp. | Ref. |
| Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
| Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Combretaceae | Combretum albopunctatum Suesseng | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
| Plantae | Lauraceae | Litsea glaucescens | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
| Plantae | Pinaceae | Pinus cembra  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| Plantae | Piperaceae | Piper gaudichaudianum | Ref. |
| Plantae | Piperaceae | Piper hostmannianum | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Turneraceae | Turnera subulata | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF.  | Ref. |
|
|
zoom in
| Organism | Goniothalamus griffithii | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Kinghorn, et al., Planta Med, 70, (2004), 691.
Kuo, et al., Planta Med, 70, (2004), 1237.
Calixto, et al., Planta Med, 69, (2003), 973.
Biondi, et al., JNP, 66, (2003), 477.
Mu, et al., Planta Med, 69, (2003), 826 |
|---|
|