| Name |
Narirutin |
| Formula |
C27H32O14 |
| Mw |
580.17920573 |
| CAS RN |
14259-46-2 |
| C_ID |
C00000984
, 
|
| InChIKey |
HXTFHSYLYXVTHC-RGNCLQGVNA-N |
| InChICode |
InChI=1S/C27H32O14/c1-10-20(31)22(33)24(35)26(38-10)37-9-18-21(32)23(34)25(36)27(41-18)39-13-6-14(29)19-15(30)8-16(40-17(19)7-13)11-2-4-12(28)5-3-11/h2-7,10,16,18,20-29,31-36H,8-9H2,1H3/t10-,16+,18-,20+,21-,22-,23+,24+,25-,26-,27-/m1/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3cc(O)c4c(c3)O[C@H](c3ccc(O)cc3)CC4=O)C(O)[C@@H](O)[C@@H]2O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asteraceae | Cynara scolymus  | Ref. |
| Plantae | Lamiaceae | Acinos suaveolens | Ref. |
| Plantae | Rubiaceae | Hamelia patens  | Ref. |
| Plantae | Rutaceae | Citrus aurantium L. var. amara  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
| Plantae | Rutaceae | Citrus unshiu Markovich  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Cynara scolymus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 317,Flavanones and dihydroflavonols
Mizelle,Alalyt.Biochem.,12,(1965),316 |
|---|
|