| Name |
epi-Gallocatechin 3-O-gallate Epigallocatechin gallate (-)-Epigallocatechin gallate (2R-cis)-3,4-Dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester 3,4,5-trihydroxybenzoic acid |
| Formula |
C22H18O11 |
| Mw |
458.08491142 |
| CAS RN |
989-51-5 |
| C_ID |
C00000958
, 
|
| InChIKey |
WMBWREPUVVBILR-PUUMMNGONA-N |
| InChICode |
InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21-/m1/s1 |
| SMILES |
O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cistaceae | Cistus incanus | Ref. |
| Plantae | Cistaceae | Cistus salviifolius | Ref. |
| Plantae | Crassulaceae | Sedum sediforme | Ref. |
| Plantae | Cunoniaceae | Davidsonia pruriens | Ref. |
| Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
| Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
| Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
| Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Ericaceae | Rhododendron ungernii | Ref. |
| Plantae | Euphorbiaceae | Mallotus japonicus | Ref. |
| Plantae | Fabaceae | Acacia pycnantha | Ref. |
| Plantae | Fabaceae | Stryphnodendron adstringens | Ref. |
| Plantae | Fabaceae | Trifolium pratense | Ref. |
| Plantae | Hamamelidaceae | Hamamelis virginiana | Ref. |
| Plantae | Labiatae | Salvia officinalis | Ref. |
| Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Myricaceae | Myrica esculenta | Ref. |
| Plantae | Myricaceae | Myrica rubra | Ref. |
| Plantae | Myrtaceae | Eugenia edulis | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola L. | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
| Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
| Plantae | Rutaceae | Citrus limon | Ref. |
| Plantae | Sapotaceae | Sideroxylon inerme L. | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
| Plantae | Theaceae | Thea sinensis | Ref. |
| Plantae | Turneraceae | Turnera ulmifolia | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
| Organism | Cistus salviifolius | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Bradfield,J.Chem.Soc.,(1948),2249 |
|---|
|