| Name |
7,8-Diaminopelargonic acid 7,8-Diaminononanoate 7,8-Diaminononanoic acid |
| Formula |
C9H20N2O2 |
| Mw |
188.1524779 |
| CAS RN |
21738-21-6 |
| C_ID |
C00000759
, 
|
| InChIKey |
KCEGBPIYGIWCDH-HGXVMFPFNA-N |
| InChICode |
InChI=1S/C9H20N2O2/c1-7(10)8(11)5-3-2-4-6-9(12)13/h7-8H,2-6,10-11H2,1H3,(H,12,13)/t7-,8+/m0/s1 |
| SMILES |
C[C@H](N)[C@H](N)CCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Bacillaceae | Bacillus subtilis  | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| - | - | Paraburkholderia phymatum | Ref. |
|
|
zoom in
| Organism | Escherichia coli | | Reference | DeMoll,Escherichia coli and Salmonella.Cellular and Molecular Biology,ASM Press.Washington DC,vol 1,(1996),p704 |
|---|
|