| Name |
Cannabisin F |
| Formula |
C36H36N2O8 |
| Mw |
624.24716614 |
| CAS RN |
163136-19-4 |
| C_ID |
C00000669
, 
|
| InChIKey |
JCUQMHMUDDMCSX-AADBSILNSA-N |
| InChICode |
InChI=1S/C36H36N2O8/c1-44-32-22-27(7-14-30(32)41)23-34(36(43)38-20-18-25-5-12-29(40)13-6-25)46-31-15-8-26(21-33(31)45-2)9-16-35(42)37-19-17-24-3-10-28(39)11-4-24/h3-16,21-23,39-41H,17-20H2,1-2H3,(H,37,42)(H,38,43)/b16-9+,34-23- |
| SMILES |
COc1cc(/C=C(Oc2ccc(/C=C/C(=O)NCCc3ccc(O)cc3)cc2OC)C(=O)NCCc2ccc(O)cc2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
|
|
zoom in
| Organism | Datura metel | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|