| Name |
(-)-Thannilignan
Thannilignan |
| Formula |
C19H22O5 |
| Mw |
330.14672381 |
| CAS RN |
192220-06-7 |
| C_ID |
C00000658
, 
|
| InChIKey |
UICXJFXGPMLFAQ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H22O5/c1-13(9-14-3-6-16(21)7-4-14)19(23,12-20)11-15-5-8-17(24-2)10-18(15)22/h3-8,10,20-23H,1,9,11-12H2,2H3/t19-/m0/s1 |
| SMILES |
C=C(Cc1ccc(O)cc1)C(O)(CO)Cc1ccc(OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Terminalia bellerica  | Ref. |
| Plantae | Combretaceae | Terminalia bellirica | Ref. |
| Plantae | Combretaceae | Terminalia sericea | Ref. |
| Plantae | Combretaceae | Terminalia superb | Ref. |
|
|
zoom in
| Organism | Terminalia bellirica |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
