| Name |
Isomagnolol |
| Formula |
C18H18O2 |
| Mw |
266.13067982 |
| CAS RN |
87688-90-2 |
| C_ID |
C00000592
, 
|
| InChIKey |
ROPDWYIWHWKVLI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H18O2/c1-3-5-14-7-10-16(11-8-14)20-18-13-15(6-4-2)9-12-17(18)19/h3-4,7-13,19H,1-2,5-6H2 |
| SMILES |
C=CCc1ccc(Oc2cc(CC=C)ccc2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Illiciaceae | Illicium fargesii | Ref. |
| Plantae | Lauraceae | Sassafras randaiense | Ref. |
| Plantae | Magnoliaceae | Magnolia biloba | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
|
|
zoom in
| Organism | Sassafras randaiense | | Reference | Gottlieb,Natural Products og Woody Plants-Chemicals Extraneous to the Lignocellulosic Cell Wall.Springer-Verlag Berlin,(1989),p439 |
|---|
|