| Name |
Perovskone |
| Formula |
C30H42O3 |
| Mw |
450.31339521 |
| CAS RN |
142132-39-6 |
| C_ID |
C00000501
, 
|
| InChIKey |
DVCBBGWACDEUAQ-NRWPDTPENA-N |
| InChICode |
InChI=1S/C30H42O3/c1-17(2)22-23(31)27-13-9-18(3)19-15-21-26(6,7)32-24(22)30(21)29(19,27)16-28(33-30)12-8-11-25(4,5)20(28)10-14-27/h9,17,19-21H,8,10-16H2,1-7H3/t19-,20-,21+,27+,28-,29-,30-/m0/s1 |
| SMILES |
CC1=CC[C@]23CCC4C(C)(C)CCC[C@]45C[C@]24C1C[C@@H]1C(C)(C)OC(=C(C(C)C)C3=O)[C@@]14O5 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Perovskia abrotanoides  | Ref. |
| Plantae | Labiatae | Salvia bucharica | Ref. |
|
|
zoom in
| Organism | Salvia bucharica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|