| Name |
12-Hydroxyjasmonic acid |
| Formula |
C12H18O4 |
| Mw |
226.12050906 |
| CAS RN |
140631-27-2 |
| C_ID |
C00000233
, 
|
| InChIKey |
RZGFUGXQKMEMOO-NARLHRRKNA-N |
| InChICode |
InChI=1S/C12H18O4/c13-7-3-1-2-4-10-9(8-12(15)16)5-6-11(10)14/h1-2,9-10,13H,3-8H2,(H,15,16)/b2-1-/t9-,10-/m1/s1 |
| SMILES |
O=C(O)C[C@H]1CCC(=O)[C@@H]1C/C=CCCO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Origanum dubium | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Solanaceae | Solanum demissum | Ref. |
|
|
zoom in
| Organism | Origanum vulgare | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|