| Name |
Nicotinamide Vitamin B |
| Formula |
C6H6N2O |
| Mw |
122.04801283 |
| CAS RN |
98-92-0 |
| C_ID |
C00000209
, 
|
| InChIKey |
DFPAKSUCGFBDDF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H6N2O/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9) |
| SMILES |
NC(=O)c1cccnc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp L-Phe L-His |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Anemarrhenaceae | Anemarrhena asphodeloides  | Ref. |
| Plantae | Araceae | Colocasia escultenta | Ref. |
| Plantae | Araceae | Pinellia pedatisecta | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Anemarrhena asphodeloides | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
LI, et al., Chem Pharm Bull, 50, (2002), 1305.
LEU, et al., Chem Pharm Bull, 53, (2005), 853 |
|---|
|