| Name |
Indole-3-acetonitrile IAN |
| Formula |
C10H8N2 |
| Mw |
156.06874827 |
| CAS RN |
771-51-7 |
| C_ID |
C00000107
, 
|
| InChIKey |
DMCPFOBLJMLSNX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H8N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5H2 |
| SMILES |
N#CCc1c[nH]c2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Stevia rebaudiana  | Ref. |
| Plantae | Balsaminaceae | Impatiens balsamina  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Brassica pekinensis  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Cruciferae | Thellungiella halophila | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Fabaceae | Phaseolus mungo  | Ref. |
| Plantae | Hydrodictyaceae | Pediastrum boryanum | Ref. |
| Plantae | Lygodiaceae/Schizaeaceae | Lygodium flexuosum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Vitaceae | Vitis spp.  | Ref. |
| - | - | Brassicaceae | Ref. |
|
|
zoom in
| Organism | Impatiens balsamina | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|