| Name |
Nonin C |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
897627-41-7 |
| C_ID |
C00064608
|
| InChIKey |
UYVACYRYBGDJSP-CLROSIBMSA-N |
| InChICode |
InChI=1S/C17H16O5/c1-16-8-7-12-13(15(19)20-2)14(18)10-5-3-4-6-11(10)17(12,22-16)21-9-16/h3-8,12-13H,9H2,1-2H3/t12-,13-,16+,17-/m0/s1 |
| SMILES |
COC(=O)C1C(=O)c2ccccc2C23OCC(C)(C=CC12)O3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
|
|
zoom in
| Organism | Morinda citrifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|