| Name |
Vitisinol B |
| Formula |
C35H26O8 |
| Mw |
574.16276781 |
| CAS RN |
848985-80-8 |
| C_ID |
C00064572
|
| InChIKey |
LIOBMRCYNQGSIE-KLSCSJJOSA-N |
| InChICode |
InChI=1S/C35H26O8/c36-16-17-1-10-27(41)24(11-17)31-25-13-23(40)15-29-33(25)34(35(43-29)19-4-8-21(38)9-5-19)26-12-22(39)14-28(42)32(26)30(31)18-2-6-20(37)7-3-18/h1-16,30-31,34-35,37-42H/t30-,31+,34+,35-/m1/s1 |
| SMILES |
O=Cc1ccc(O)c(C2c3cc(O)cc4c3C(c3cc(O)cc(O)c3C2c2ccc(O)cc2)C(c2ccc(O)cc2)O4)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
|
|
zoom in
| Organism | Vitis amurensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|