| Name |
trans-Caffeic acid methyl ester |
| Formula |
C10H10O4 |
| Mw |
194.05790881 |
| CAS RN |
67667-67-8 |
| C_ID |
C00064486
|
| InChIKey |
OCNYGKNIVPVPPX-HWKANZROSA-N |
| InChICode |
InChI=1S/C10H10O4/c1-14-10(13)5-3-7-2-4-8(11)9(12)6-7/h2-6,11-12H,1H3/b5-3+ |
| SMILES |
COC(=O)C=Cc1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|