| Name |
Withanolide F |
| Formula |
C28H38O6 |
| Mw |
470.26683895 |
| CAS RN |
63115-49-1 |
| C_ID |
C00064451
|
| InChIKey |
HYSIDFWCYWFQMQ-MEZCUPPISA-N |
| InChICode |
InChI=1S/C28H38O6/c1-16-15-22(34-23(30)17(16)2)26(5,31)28(33)14-13-27(32)20-10-9-18-7-6-8-21(29)25(18,4)19(20)11-12-24(27,28)3/h6-7,9,19-20,22,31-33H,8,10-15H2,1-5H3/t19-,20+,22+,24-,25-,26-,27+,28-/m0/s1 |
| SMILES |
CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC=C5C=CCC(=O)C5(C)C4CCC32C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Withania coagulans  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
|
|
zoom in
| Organism | Withania coagulans | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|