| Name |
4-Methoxy-6-(2',4'-dihydroxy-6'-methylphenyl)-pyran-2-one Aloenin aglycone |
| Formula |
C13H12O5 |
| Mw |
248.06847349 |
| CAS RN |
59163-53-0 |
| C_ID |
C00064423
|
| InChIKey |
GJWNAMOGOKAELX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H12O5/c1-7-3-8(14)4-10(15)13(7)11-5-9(17-2)6-12(16)18-11/h3-6,14-15H,1-2H3 |
| SMILES |
COc1cc(-c2c(C)cc(O)cc2O)oc(=O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe nyeriensis | Ref. |
| Plantae | Asphodelaceae | Aloe nyeriensis var. kedongensis | Ref. |
|
|
zoom in
| Organism | Aloe nyeriensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|