| Name |
Harmic acid methyl ester |
| Formula |
C14H12N2O3 |
| Mw |
256.08479226 |
| CAS RN |
57498-79-0 |
| C_ID |
C00064416
|
| InChIKey |
GGTFWDPYRXONGD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H12N2O3/c1-18-8-3-4-9-10-5-6-15-13(14(17)19-2)12(10)16-11(9)7-8/h3-7,16H,1-2H3 |
| SMILES |
COC(=O)c1nccc2c1[nH]c1cc(OC)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Nitrariaceae | Peganum harmala  | Ref. |
|
|
zoom in
| Organism | Peganum harmala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|