| Name |
3-(3'-Acetoxytropoyloxy)tropane |
| Formula |
C19H25NO4 |
| Mw |
331.17835829 |
| CAS RN |
535995-20-1 |
| C_ID |
C00064390
|
| InChIKey |
FFTQFHULPHYOIS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H25NO4/c1-13(21)23-12-18(14-6-4-3-5-7-14)19(22)24-17-10-15-8-9-16(11-17)20(15)2/h3-7,15-18H,8-12H2,1-2H3 |
| SMILES |
CC(=O)OCC(C(=O)OC1CC2CCC(C1)N2C)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Datura ceratocaula  | Ref. |
| Plantae | Solanaceae | Datura stramonium  | Ref. |
|
|
zoom in
| Organism | Datura ceratocaula | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|