| Name |
Laccaic acid D methyl ester |
| Formula |
C17H12O7 |
| Mw |
328.05830274 |
| CAS RN |
53254-85-6 |
| C_ID |
C00064385
|
| InChIKey |
NBIBEHMMFJQZQW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H12O7/c1-6-12-9(5-11(20)13(6)17(23)24-2)15(21)8-3-7(18)4-10(19)14(8)16(12)22/h3-5,18-20H,1-2H3 |
| SMILES |
COC(=O)c1c(O)cc2c(c1C)C(=O)c1c(O)cc(O)cc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe graminicola | Ref. |
| Plantae | Asphodelaceae | Aloe saponaria  | Ref. |
|
|
zoom in
| Organism | Aloe graminicola | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|