| Name |
Taiwanhomoflavone B |
| Formula |
C32H24O10 |
| Mw |
568.13694699 |
| CAS RN |
509077-91-2 |
| C_ID |
C00064370
|
| InChIKey |
|
| InChICode |
InChI=1S/C32H24O10/c1-15-20(34)11-25-28(30(15)37)21(35)12-24(41-25)17-5-9-19(10-6-17)40-32-27(39-2)14-26-29(31(32)38)22(36)13-23(42-26)16-3-7-18(33)8-4-16/h3-11,13-14,24,33-34,37-38H,12H2,1-2H3/t24-/m0/s1;InChI=1S/C32H24O10/c1-15-20(34)11-25-28(30(15)37)21(35)12-24(41-25)17-5-9-19(10-6-17)40-32-27(39-2)14-26-29(31(32)38)22(36)13-23(42-26)16-3-7-18(33)8-4-16/h3-11,13-14,24,33-34,37-38H,12H2,1-2H3 |
| SMILES |
COc1cc2oc(-c3ccc(O)cc3)cc(=O)c2c(O)c1Oc1ccc(C2CC(=O)c3c(cc(O)c(C)c3O)O2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus wilsoniana | Ref. |
|
|
zoom in
| Organism | Cephalotaxus wilsoniana |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
