| Name |
trans-Cinnamoylcocaine |
| Formula |
C19H23NO4 |
| Mw |
329.16270823 |
| CAS RN |
50763-20-7 |
| C_ID |
C00064367
|
| InChIKey |
MQIXMJWNEKUAOZ-UYCDZTDFSA-N |
| InChICode |
InChI=1S/C19H23NO4/c1-20-14-9-10-15(20)18(19(22)23-2)16(12-14)24-17(21)11-8-13-6-4-3-5-7-13/h3-8,11,14-16,18H,9-10,12H2,1-2H3/b11-8+/t14-,15+,16-,18+/m0/s1 |
| SMILES |
COC(=O)C1C(OC(=O)C=Cc2ccccc2)CC2CCC1N2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| - | - | Erythroxylon coca  | Ref. |
| - | - | Erythroxylon novogranatense | Ref. |
|
|
zoom in
| Organism | Erythroxylum coca | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|