| Name |
Withanolide G |
| Formula |
C28H38O5 |
| Mw |
454.27192432 |
| CAS RN |
50657-10-8 |
| C_ID |
C00064362
|
| InChIKey |
ZRJOVYPUBHQEES-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C28H38O5/c1-16-15-23(33-24(30)17(16)2)27(5,31)21-12-14-28(32)20-10-9-18-7-6-8-22(29)26(18,4)19(20)11-13-25(21,28)3/h6,8-9,19-21,23,31-32H,7,10-15H2,1-5H3 |
| SMILES |
CC1=C(C)C(=O)OC(C(C)(O)C2CCC3(O)C4CC=C5CC=CC(=O)C5(C)C4CCC23C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Withania coagulans  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
|
|
zoom in
| Organism | Withania coagulans | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|