| Name |
5-O-Caffeoylquinic acid butyl ester |
| Formula |
C20H26O9 |
| Mw |
410.15768243 |
| CAS RN |
409361-64-4 |
| C_ID |
C00064320
|
| InChIKey |
VNLREARKISTOAD-WHRXQRCBSA-N |
| InChICode |
InChI=1S/C20H26O9/c1-2-3-8-28-19(26)20(27)10-15(23)18(25)16(11-20)29-17(24)7-5-12-4-6-13(21)14(22)9-12/h4-7,9,15-16,18,21-23,25,27H,2-3,8,10-11H2,1H3/b7-5+/t15-,16-,18+,20-/m1/s1 |
| SMILES |
CCCCOC(=O)C1(O)CC(O)C(O)C(OC(=O)C=Cc2ccc(O)c(O)c2)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Capsicum annuum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|