| Name |
Sarpagan |
| Formula |
C19H22N2 |
| Mw |
278.17829872 |
| CAS RN |
3921-76-4 |
| C_ID |
C00064317
|
| InChIKey |
ACGYPBAJFJKMMM-GHUKBTIXSA-N |
| InChICode |
InChI=1S/C19H22N2O/c1-3-11-9-21-17-8-15-14-6-12(22)4-5-16(14)20-19(15)18(21)7-13(11)10(17)2/h3-6,10,13,17-18,20,22H,7-9H2,1-2H3/b11-3-/t10-,13-,17+,18+/m1/s1 |
| SMILES |
CC=C1CN2C3CC1C(C)C2Cc1c3[nH]c2ccc(O)cc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Rauwolfia caffra | Ref. |
| Plantae | Apocynaceae | Rauwolfia nitida | Ref. |
| Plantae | Apocynaceae | Rauwolfia vomitoria  | Ref. |
|
|
zoom in
| Organism | Rauwolfia caffra | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|