| Name |
(+)-Viniferol A |
| Formula |
C56H42O12 |
| Mw |
906.26762681 |
| CAS RN |
349085-51-4 |
| C_ID |
C00064296
|
| InChIKey |
LSNFJDFYAZDWFX-UCYPNASZSA-N |
| InChICode |
InChI=1S/C56H42O12/c57-30-9-1-25(2-10-30)44-47-38(20-36(63)22-40(47)65)50-48-39(21-37(64)23-42(48)67-56(50)28-7-15-33(60)16-8-28)49-45(26-3-11-31(58)12-4-26)51-41(66)24-43-52(54(51)53(44)49)46(29-17-34(61)19-35(62)18-29)55(68-43)27-5-13-32(59)14-6-27/h1-24,44-46,49-50,53,55-66H/t44-,45+,46-,49-,50-,53-,55+,56+/m0/s1 |
| SMILES |
Oc1ccc(C2Oc3cc(O)c4c(c3C2c2cc(O)cc(O)c2)C2C(c3ccc(O)cc3)c3c(O)cc(O)cc3C3c5c(cc(O)cc5C2C4c2ccc(O)cc2)OC3c2ccc(O)cc2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis labrusca  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis amurensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|