| Name |
Orientaloside |
| Formula |
C25H32O13 |
| Mw |
540.18429111 |
| CAS RN |
339165-13-8 |
| C_ID |
C00064288
|
| InChIKey |
PFGAJVHSRWCMOQ-PKCJLHEISA-N |
| InChICode |
InChI=1S/C25H32O13/c1-9-6-11-4-3-5-12(16(11)19(31)15(9)10(2)28)35-25-22(34)23(18(30)14(8-27)37-25)38-24-21(33)20(32)17(29)13(7-26)36-24/h3-6,13-14,17-18,20-27,29-34H,7-8H2,1-2H3/t13-,14-,17-,18-,20+,21-,22-,23+,24+,25-/m1/s1 |
| SMILES |
CC(=O)c1c(C)cc2cccc(OC3OC(CO)C(O)C(OC4OC(CO)C(O)C(O)C4O)C3O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Rumex nepalensis  | Ref. |
| Plantae | Polygonaceae | Rumex patientia  | Ref. |
|
|
zoom in
| Organism | Rumex nepalensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|