| Name |
Parfumidine |
| Formula |
C21H21NO5 |
| Mw |
367.14197279 |
| CAS RN |
31225-67-9 |
| C_ID |
C00064274
|
| InChIKey |
PSBYWDSXDKNYKB-NRFANRHFSA-N |
| InChICode |
InChI=1S/C21H21NO5/c1-22-7-6-12-8-16(24-2)17(25-3)9-14(12)21(22)10-13-4-5-15-19(27-11-26-15)18(13)20(21)23/h4-5,8-9H,6-7,10-11H2,1-3H3/t21-/m0/s1 |
| SMILES |
COc1cc2c(cc1OC)C1(Cc3ccc4c(c3C1=O)OCO4)N(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
|
|
zoom in
| Organism | Fumaria densiflora | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|