| Name |
Salvatrione |
| Formula |
C30H42O5 |
| Mw |
482.30322445 |
| CAS RN |
304655-52-5 |
| C_ID |
C00064266
|
| InChIKey |
FDCJOJWJGFRBKE-PIVCDPACSA-N |
| InChICode |
InChI=1S/C30H42O5/c1-8-18-14-19-21(26(6,7)34)30(17(2)3)23(32)22(31)29(19)16-28(35)12-9-11-25(4,5)20(28)10-13-27(29,15-18)24(30)33/h8,14,17,19-21,34-35H,1,9-13,15-16H2,2-7H3/t19-,20?,21+,27+,28?,29-,30+/m0/s1 |
| SMILES |
C=CC1=CC2C(C(C)(C)O)C3(C(C)C)C(=O)C(=O)C24CC2(O)CCCC(C)(C)C2CCC4(C1)C3=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia bucharica | Ref. |
| Plantae | Labiatae | Salvia hydrangea | Ref. |
|
|
zoom in
| Organism | Salvia bucharica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|